C19H32N4O4 — CID 21303578
N-cyano-5-[3-[5-(cyanoamino)-4,4-dimethyl-5-oxopentoxy]propoxy]-2,2-dimethylpentanamide (PubChem CID 21303578) has the molecular formula C19H32N4O4 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-cyano-5-[3-[5-(cyanoamino)-4,4-dimethyl-5-oxopentoxy]propoxy]-2,2-dimethylpentanamide.
| Compound Name | N-cyano-5-[3-[5-(cyanoamino)-4,4-dimethyl-5-oxopentoxy]propoxy]-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 21303578 |
| Molecular Formula | C19H32N4O4 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.24 |
| IUPAC Name | N-cyano-5-[3-[5-(cyanoamino)-4,4-dimethyl-5-oxopentoxy]propoxy]-2,2-dimethylpentanamide |
| SMILES | CC(C)(CCCOCCCOCCCC(C)(C)C(=O)NC#N)C(=O)NC#N |
| InChI | InChI=1S/C19H32N4O4/c1-18(2,16(24)22-14-20)8-5-10-26-12-7-13-27-11-6-9-19(3,4)17(25)23-15-21/h5-13H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | FXGOZYNTVGJRBN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|