C17H34O3 — CID 21304156
2,5-bis(methoxymethyl)-2,3,3,4,4,5,6,6-octamethyloxane (PubChem CID 21304156) has the molecular formula C17H34O3 and a molecular weight of 286.46 g/mol. Its IUPAC name is 2,5-bis(methoxymethyl)-2,3,3,4,4,5,6,6-octamethyloxane.
| Compound Name | 2,5-bis(methoxymethyl)-2,3,3,4,4,5,6,6-octamethyloxane |
|---|---|
| PubChem CID | 21304156 |
| Molecular Formula | C17H34O3 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.25 |
| IUPAC Name | 2,5-bis(methoxymethyl)-2,3,3,4,4,5,6,6-octamethyloxane |
| SMILES | COCC1(C)OC(C)(C)C(C)(COC)C(C)(C)C1(C)C |
| InChI | InChI=1S/C17H34O3/c1-13(2)14(3,4)17(8,12-19-10)20-15(5,6)16(13,7)11-18-9/h11-12H2,1-10H3 |
| InChIKey | PLNSUYLBWHIMSS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |