C21H30 — CID 21304177
2-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene (PubChem CID 21304177) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 21304177 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-[(1E,3E,5E,7E)-3,7-dimethyldeca-1,3,5,7,9-pentaenyl]-1,3,3-trimethylcyclohexene |
| SMILES | C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C21H30/c1-7-10-17(2)11-8-12-18(3)14-15-20-19(4)13-9-16-21(20,5)6/h7-8,10-12,14-15H,1,9,13,16H2,2-6H3/b11-8+,15-14+,17-10+,18-12+ |
| InChIKey | YAPCPFGFCKSMKW-VAIZSXGKSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|