About 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one
3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one (PubChem CID 21304406) has the molecular formula C12H22O3
and a molecular weight of 214.30 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one |
| PubChem CID | 21304406 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one |
| SMILES | CCC(C)(CO)CC1C(=O)OCC1(C)C |
| InChI | InChI=1S/C12H22O3/c1-5-12(4,7-13)6-9-10(14)15-8-11(9,2)3/h9,13H,5-8H2,1-4H3 |
| InChIKey | RMZUEBZQGZVJSR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one?
The IUPAC name of 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one (CID 21304406) is 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one.
What is the SMILES notation for 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one?
The canonical SMILES for 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one is CCC(C)(CO)CC1C(=O)OCC1(C)C.
What is the InChIKey of 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one?
The InChIKey is RMZUEBZQGZVJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3/c1-5-12(4,7-13)6-9-10(14)15-8-11(9,2)3/h9,13H,5-8H2,1-4H3.
What are the key properties of 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one?
3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one has a molecular weight of 214.30 g/mol, XLogP of 1.98, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(hydroxymethyl)-2-methylbutyl]-4,4-dimethyloxolan-2-one is sourced from PubChem (CID 21304406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).