C19H11Cl3N4O4S — CID 21304505
(E)-3-[5-chloro-1-(2,5-dichlorophenyl)sulfonylindol-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one (PubChem CID 21304505) has the molecular formula C19H11Cl3N4O4S and a molecular weight of 497.75 g/mol. Its IUPAC name is (E)-3-[5-chloro-1-(2,5-dichlorophenyl)sulfonylindol-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[5-chloro-1-(2,5-dichlorophenyl)sulfonylindol-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 21304505 |
| Molecular Formula | C19H11Cl3N4O4S |
| Molecular Weight | 497.75 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | (E)-3-[5-chloro-1-(2,5-dichlorophenyl)sulfonylindol-3-yl]-3-hydroxy-1-(1H-1,2,4-triazol-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C(/O)c1cn(S(=O)(=O)c2cc(Cl)ccc2Cl)c2ccc(Cl)cc12)c1ncn[nH]1 |
| InChI | InChI=1S/C19H11Cl3N4O4S/c20-10-2-4-15-12(5-10)13(16(27)7-17(28)19-23-9-24-25-19)8-26(15)31(29,30)18-6-11(21)1-3-14(18)22/h1-9,27H,(H,23,24,25)/b16-7+ |
| InChIKey | MEUVKSNCWDTZPR-FRKPEAEDSA-N |
| XLogP | 4.74 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.75 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|