About N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine
N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine (PubChem CID 21305352) has the molecular formula C42H83NO2
and a molecular weight of 634.13 g/mol. Its IUPAC name is N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine |
| PubChem CID | 21305352 |
| Molecular Formula | C42H83NO2 |
| Molecular Weight | 634.13 g/mol |
| Exact Mass | 633.64 |
| IUPAC Name | N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine |
| SMILES | CCCCCCCC/C=C/CCCCCCCCOCC(CN(C)CC)OCCCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C42H83NO2/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44-41-42(40-43(4)7-3)45-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h20-23,42H,5-19,24-41H2,1-4H3/b22-20+,23-21+ |
| InChIKey | LFSPVKPRBRYNQH-DQPVQCHKSA-N |
| XLogP | 13.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.13 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine?
The IUPAC name of N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine (CID 21305352) is N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine.
What is the SMILES notation for N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine?
The canonical SMILES for N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine is CCCCCCCC/C=C/CCCCCCCCOCC(CN(C)CC)OCCCCCCCC/C=C/CCCCCCCC.
What is the InChIKey of N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine?
The InChIKey is LFSPVKPRBRYNQH-DQPVQCHKSA-N. The full InChI is InChI=1S/C42H83NO2/c1-5-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-44-41-42(40-43(4)7-3)45-39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-6-2/h20-23,42H,5-19,24-41H2,1-4H3/b22-20+,23-21+.
What are the key properties of N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine?
N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine has a molecular weight of 634.13 g/mol, XLogP of 13.41, 38 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2,3-bis[(E)-octadec-9-enoxy]propan-1-amine is sourced from PubChem (CID 21305352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).