About 3-fluoro-3-methoxycyclohexa-1,4-diene
3-fluoro-3-methoxycyclohexa-1,4-diene (PubChem CID 21305421) has the molecular formula C7H9FO
and a molecular weight of 128.15 g/mol. Its IUPAC name is 3-fluoro-3-methoxycyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 3-fluoro-3-methoxycyclohexa-1,4-diene |
| PubChem CID | 21305421 |
| Molecular Formula | C7H9FO |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 3-fluoro-3-methoxycyclohexa-1,4-diene |
| SMILES | COC1(F)C=CCC=C1 |
| InChI | InChI=1S/C7H9FO/c1-9-7(8)5-3-2-4-6-7/h3-6H,2H2,1H3 |
| InChIKey | ROEXALNGPMHIFV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-3-methoxycyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-methoxycyclohexa-1,4-diene?
The IUPAC name of 3-fluoro-3-methoxycyclohexa-1,4-diene (CID 21305421) is 3-fluoro-3-methoxycyclohexa-1,4-diene.
What is the SMILES notation for 3-fluoro-3-methoxycyclohexa-1,4-diene?
The canonical SMILES for 3-fluoro-3-methoxycyclohexa-1,4-diene is COC1(F)C=CCC=C1.
What is the InChIKey of 3-fluoro-3-methoxycyclohexa-1,4-diene?
The InChIKey is ROEXALNGPMHIFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FO/c1-9-7(8)5-3-2-4-6-7/h3-6H,2H2,1H3.
What are the key properties of 3-fluoro-3-methoxycyclohexa-1,4-diene?
3-fluoro-3-methoxycyclohexa-1,4-diene has a molecular weight of 128.15 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-methoxycyclohexa-1,4-diene is sourced from PubChem (CID 21305421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).