C19H30N5O8-3 — CID 21305870
2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(3-oxopropylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 21305870) has the molecular formula C19H30N5O8-3 and a molecular weight of 456.48 g/mol. Its IUPAC name is 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(3-oxopropylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(3-oxopropylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 21305870 |
| Molecular Formula | C19H30N5O8-3 |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 2-[4,7-bis(carboxylatomethyl)-10-[2-oxo-2-(3-oxopropylamino)ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | O=CCCNC(=O)CN1CCN(CC(=O)[O-])CCN(CC(=O)[O-])CCN(CC(=O)[O-])CC1 |
| InChI | InChI=1S/C19H33N5O8/c25-11-1-2-20-16(26)12-21-3-5-22(13-17(27)28)7-9-24(15-19(31)32)10-8-23(6-4-21)14-18(29)30/h11H,1-10,12-15H2,(H,20,26)(H,27,28)(H,29,30)(H,31,32)/p-3 |
| InChIKey | WJNGFMIBHFAJPS-UHFFFAOYSA-K |
| XLogP | -6.84 |
| TPSA | 179.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | -6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|