About 3-(difluoromethyl)-1,4-dimethylimidazol-2-one
3-(difluoromethyl)-1,4-dimethylimidazol-2-one (PubChem CID 21306280) has the molecular formula C6H8F2N2O
and a molecular weight of 162.14 g/mol. Its IUPAC name is 3-(difluoromethyl)-1,4-dimethylimidazol-2-one.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-1,4-dimethylimidazol-2-one |
| PubChem CID | 21306280 |
| Molecular Formula | C6H8F2N2O |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 3-(difluoromethyl)-1,4-dimethylimidazol-2-one |
| SMILES | Cc1cn(C)c(=O)n1C(F)F |
| InChI | InChI=1S/C6H8F2N2O/c1-4-3-9(2)6(11)10(4)5(7)8/h3,5H,1-2H3 |
| InChIKey | INSXEGKWFUAAED-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(difluoromethyl)-1,4-dimethylimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-1,4-dimethylimidazol-2-one?
The IUPAC name of 3-(difluoromethyl)-1,4-dimethylimidazol-2-one (CID 21306280) is 3-(difluoromethyl)-1,4-dimethylimidazol-2-one.
What is the SMILES notation for 3-(difluoromethyl)-1,4-dimethylimidazol-2-one?
The canonical SMILES for 3-(difluoromethyl)-1,4-dimethylimidazol-2-one is Cc1cn(C)c(=O)n1C(F)F.
What is the InChIKey of 3-(difluoromethyl)-1,4-dimethylimidazol-2-one?
The InChIKey is INSXEGKWFUAAED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O/c1-4-3-9(2)6(11)10(4)5(7)8/h3,5H,1-2H3.
What are the key properties of 3-(difluoromethyl)-1,4-dimethylimidazol-2-one?
3-(difluoromethyl)-1,4-dimethylimidazol-2-one has a molecular weight of 162.14 g/mol, XLogP of 0.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-1,4-dimethylimidazol-2-one is sourced from PubChem (CID 21306280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).