C21H29N2O4+ — CID 21306340
ethyl 4-[3-[3-[(1-hydroxypyridin-1-ium-2-yl)amino]propoxy]phenyl]-3-methylbutanoate (PubChem CID 21306340) has the molecular formula C21H29N2O4+ and a molecular weight of 373.47 g/mol. Its IUPAC name is ethyl 4-[3-[3-[(1-hydroxypyridin-1-ium-2-yl)amino]propoxy]phenyl]-3-methylbutanoate.
| Compound Name | ethyl 4-[3-[3-[(1-hydroxypyridin-1-ium-2-yl)amino]propoxy]phenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 21306340 |
| Molecular Formula | C21H29N2O4+ |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | ethyl 4-[3-[3-[(1-hydroxypyridin-1-ium-2-yl)amino]propoxy]phenyl]-3-methylbutanoate |
| SMILES | CCOC(=O)CC(C)Cc1cccc(OCCCNc2cccc[n+]2O)c1 |
| InChI | InChI=1S/C21H28N2O4/c1-3-26-21(24)15-17(2)14-18-8-6-9-19(16-18)27-13-7-11-22-20-10-4-5-12-23(20)25/h4-6,8-10,12,16-17,25H,3,7,11,13-15H2,1-2H3/p+1 |
| InChIKey | ZKRPMFALZPHJLZ-UHFFFAOYSA-O |
| XLogP | 3.22 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|