About 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one
3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one (PubChem CID 21306638) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one.
Molecular Properties
| Compound Name | 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one |
| PubChem CID | 21306638 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one |
| SMILES | CC(=O)C1=C(C)NC(=O)N(C(C)=O)C1c1ccccc1 |
| InChI | InChI=1S/C15H16N2O3/c1-9-13(10(2)18)14(12-7-5-4-6-8-12)17(11(3)19)15(20)16-9/h4-8,14H,1-3H3,(H,16,20) |
| InChIKey | PSJINMZFSBAMRR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one?
The IUPAC name of 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one (CID 21306638) is 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one.
What is the SMILES notation for 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one?
The canonical SMILES for 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one is CC(=O)C1=C(C)NC(=O)N(C(C)=O)C1c1ccccc1.
What is the InChIKey of 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one?
The InChIKey is PSJINMZFSBAMRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-9-13(10(2)18)14(12-7-5-4-6-8-12)17(11(3)19)15(20)16-9/h4-8,14H,1-3H3,(H,16,20).
What are the key properties of 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one?
3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one has a molecular weight of 272.30 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diacetyl-6-methyl-4-phenyl-1,4-dihydropyrimidin-2-one is sourced from PubChem (CID 21306638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).