C23H24N2O6 — CID 21307933
(3S,4S)-2-(6-amino-6-oxohexanoyl)-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid (PubChem CID 21307933) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (3S,4S)-2-(6-amino-6-oxohexanoyl)-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid.
| Compound Name | (3S,4S)-2-(6-amino-6-oxohexanoyl)-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 21307933 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (3S,4S)-2-(6-amino-6-oxohexanoyl)-3-(4-methoxyphenyl)-1-oxo-3,4-dihydroisoquinoline-4-carboxylic acid |
| SMILES | COc1ccc([C@@H]2[C@@H](C(=O)O)c3ccccc3C(=O)N2C(=O)CCCCC(N)=O)cc1 |
| InChI | InChI=1S/C23H24N2O6/c1-31-15-12-10-14(11-13-15)21-20(23(29)30)16-6-2-3-7-17(16)22(28)25(21)19(27)9-5-4-8-18(24)26/h2-3,6-7,10-13,20-21H,4-5,8-9H2,1H3,(H2,24,26)(H,29,30)/t20-,21+/m0/s1 |
| InChIKey | DROSVHNJGUHODO-LEWJYISDSA-N |
| XLogP | 2.63 |
| TPSA | 127.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|