C21H34O10 — CID 21308219
tritert-butyl (2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4,5,6-tricarboxylate (PubChem CID 21308219) has the molecular formula C21H34O10 and a molecular weight of 446.49 g/mol. Its IUPAC name is tritert-butyl (2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4,5,6-tricarboxylate.
| Compound Name | tritert-butyl (2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4,5,6-tricarboxylate |
|---|---|
| PubChem CID | 21308219 |
| Molecular Formula | C21H34O10 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | tritert-butyl (2R,3R,4R)-3,4-dihydroxy-2-(hydroxymethyl)-2,3-dihydropyran-4,5,6-tricarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=O)OC(C)(C)C)[C@](O)(C(=O)OC(C)(C)C)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C21H34O10/c1-18(2,3)29-15(24)12-13(16(25)30-19(4,5)6)28-11(10-22)14(23)21(12,27)17(26)31-20(7,8)9/h11,14,22-23,27H,10H2,1-9H3/t11-,14-,21-/m1/s1 |
| InChIKey | JOYQLHYMZGLOOX-HQHPYACNSA-N |
| XLogP | 0.75 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|