C13H22O7 — CID 21308670
1-[(2S,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-1-hydroxybut-3-en-2-one (PubChem CID 21308670) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-1-hydroxybut-3-en-2-one.
| Compound Name | 1-[(2S,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-1-hydroxybut-3-en-2-one |
|---|---|
| PubChem CID | 21308670 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-[(2S,3S,4S,5R)-6-butoxy-3,4,5-trihydroxyoxan-2-yl]-1-hydroxybut-3-en-2-one |
| SMILES | C=CC(=O)C(O)[C@H]1OC(OCCCC)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H22O7/c1-3-5-6-19-13-11(18)9(16)10(17)12(20-13)8(15)7(14)4-2/h4,8-13,15-18H,2-3,5-6H2,1H3/t8?,9-,10-,11+,12+,13?/m0/s1 |
| InChIKey | XMFSACVGMHOBCE-AREHQCKBSA-N |
| XLogP | -1.27 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|