C33H36N8O4 — CID 21308712
(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(2-pyridin-4-ylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 21308712) has the molecular formula C33H36N8O4 and a molecular weight of 608.70 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(2-pyridin-4-ylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(2-pyridin-4-ylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 21308712 |
| Molecular Formula | C33H36N8O4 |
| Molecular Weight | 608.70 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(2-pyridin-4-ylethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCCc4ccncc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C33H36N8O4/c1-2-35-31(44)28-26(42)27(43)32(45-28)41-20-38-25-29(39-33(40-30(25)41)36-18-15-21-13-16-34-17-14-21)37-19-24(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-14,16-17,20,24,26-28,32,42-43H,2,15,18-19H2,1H3,(H,35,44)(H2,36,37,39,40)/t26-,27+,28-,32+/m0/s1 |
| InChIKey | FQEXFUWMDSWNCZ-CKXMCULTSA-N |
| XLogP | 2.88 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.70 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |