C32H34N8O4 — CID 21308714
(2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(pyridin-3-ylmethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 21308714) has the molecular formula C32H34N8O4 and a molecular weight of 594.68 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(pyridin-3-ylmethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(pyridin-3-ylmethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 21308714 |
| Molecular Formula | C32H34N8O4 |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (2S,3S,4R,5R)-5-[6-(2,2-diphenylethylamino)-2-(pyridin-3-ylmethylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NCC(c4ccccc4)c4ccccc4)nc(NCc4cccnc4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C32H34N8O4/c1-2-34-30(43)27-25(41)26(42)31(44-27)40-19-37-24-28(38-32(39-29(24)40)36-17-20-10-9-15-33-16-20)35-18-23(21-11-5-3-6-12-21)22-13-7-4-8-14-22/h3-16,19,23,25-27,31,41-42H,2,17-18H2,1H3,(H,34,43)(H2,35,36,38,39)/t25-,26+,27-,31+/m0/s1 |
| InChIKey | ZBEKZOZXGHDGTO-OVDFTCDZSA-N |
| XLogP | 2.83 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |