About [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid
[(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid (PubChem CID 21308730) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid |
| PubChem CID | 21308730 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid |
| SMILES | CN(C)[C@H]1CC[C@H](NC(=O)O)C1 |
| InChI | InChI=1S/C8H16N2O2/c1-10(2)7-4-3-6(5-7)9-8(11)12/h6-7,9H,3-5H2,1-2H3,(H,11,12)/t6-,7-/m0/s1 |
| InChIKey | XFCZEAPWSVGYTJ-BQBZGAKWSA-N |
| XLogP | 0.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid?
The IUPAC name of [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid (CID 21308730) is [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid.
What is the SMILES notation for [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid?
The canonical SMILES for [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid is CN(C)[C@H]1CC[C@H](NC(=O)O)C1.
What is the InChIKey of [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid?
The InChIKey is XFCZEAPWSVGYTJ-BQBZGAKWSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-10(2)7-4-3-6(5-7)9-8(11)12/h6-7,9H,3-5H2,1-2H3,(H,11,12)/t6-,7-/m0/s1.
What are the key properties of [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid?
[(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid has a molecular weight of 172.23 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-(dimethylamino)cyclopentyl]carbamic acid is sourced from PubChem (CID 21308730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).