C28H29N3O4 — CID 21308975
3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-benzo[g]quinazoline-2,4-dione (PubChem CID 21308975) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-benzo[g]quinazoline-2,4-dione.
| Compound Name | 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-benzo[g]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 21308975 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 3-[4-[(3aR,9bR)-9-methoxy-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]butyl]-1H-benzo[g]quinazoline-2,4-dione |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCn3c(=O)[nH]c4cc5ccccc5cc4c3=O)C[C@@H]1CO2 |
| InChI | InChI=1S/C28H29N3O4/c1-34-24-9-6-10-25-26(24)22-16-30(15-20(22)17-35-25)11-4-5-12-31-27(32)21-13-18-7-2-3-8-19(18)14-23(21)29-28(31)33/h2-3,6-10,13-14,20,22H,4-5,11-12,15-17H2,1H3,(H,29,33)/t20-,22-/m1/s1 |
| InChIKey | WLIROSWBOLBFLP-IFMALSPDSA-N |
| XLogP | 3.74 |
| TPSA | 76.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|