C13H20ClNO — CID 21309134
(3R,4R)-3-methoxy-4-(3-methylphenyl)piperidine;hydrochloride (PubChem CID 21309134) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-4-(3-methylphenyl)piperidine;hydrochloride.
| Compound Name | (3R,4R)-3-methoxy-4-(3-methylphenyl)piperidine;hydrochloride |
|---|---|
| PubChem CID | 21309134 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | (3R,4R)-3-methoxy-4-(3-methylphenyl)piperidine;hydrochloride |
| SMILES | CO[C@H]1CNCC[C@@H]1c1cccc(C)c1.Cl |
| InChI | InChI=1S/C13H19NO.ClH/c1-10-4-3-5-11(8-10)12-6-7-14-9-13(12)15-2;/h3-5,8,12-14H,6-7,9H2,1-2H3;1H/t12-,13+;/m1./s1 |
| InChIKey | DETDLQJADDDDTF-KZCZEQIWSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |