C20H31N3O5 — CID 21309265
(2S)-N,2-dihydroxy-5-methyl-N-[[(2S)-3-methyl-1-(methylamino)-1-oxo-3-phenylbutan-2-yl]carbamoyl]hexanamide (PubChem CID 21309265) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is (2S)-N,2-dihydroxy-5-methyl-N-[[(2S)-3-methyl-1-(methylamino)-1-oxo-3-phenylbutan-2-yl]carbamoyl]hexanamide.
| Compound Name | (2S)-N,2-dihydroxy-5-methyl-N-[[(2S)-3-methyl-1-(methylamino)-1-oxo-3-phenylbutan-2-yl]carbamoyl]hexanamide |
|---|---|
| PubChem CID | 21309265 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (2S)-N,2-dihydroxy-5-methyl-N-[[(2S)-3-methyl-1-(methylamino)-1-oxo-3-phenylbutan-2-yl]carbamoyl]hexanamide |
| SMILES | CNC(=O)[C@@H](NC(=O)N(O)C(=O)[C@@H](O)CCC(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H31N3O5/c1-13(2)11-12-15(24)18(26)23(28)19(27)22-16(17(25)21-5)20(3,4)14-9-7-6-8-10-14/h6-10,13,15-16,24,28H,11-12H2,1-5H3,(H,21,25)(H,22,27)/t15-,16+/m0/s1 |
| InChIKey | HHSKRDUVGZXHIR-JKSUJKDBSA-N |
| XLogP | 1.80 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|