C15H24O3 — CID 21309500
(3'aS,6'aR)-6'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one (PubChem CID 21309500) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3'aS,6'aR)-6'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one.
| Compound Name | (3'aS,6'aR)-6'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one |
|---|---|
| PubChem CID | 21309500 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3'aS,6'aR)-6'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one |
| SMILES | CC[C@]12CC(=O)C[C@H]1CC1(C2)OCC(C)(C)CO1 |
| InChI | InChI=1S/C15H24O3/c1-4-14-7-12(16)5-11(14)6-15(8-14)17-9-13(2,3)10-18-15/h11H,4-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | NTXFSQVAIIHKIV-SMDDNHRTSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |