C14H22O3 — CID 21309501
(3'aS,6'aR)-5,5,6'a-trimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one (PubChem CID 21309501) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3'aS,6'aR)-5,5,6'a-trimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one.
| Compound Name | (3'aS,6'aR)-5,5,6'a-trimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one |
|---|---|
| PubChem CID | 21309501 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3'aS,6'aR)-5,5,6'a-trimethylspiro[1,3-dioxane-2,5'-3,3a,4,6-tetrahydro-1H-pentalene]-2'-one |
| SMILES | CC1(C)COC2(C[C@@H]3CC(=O)C[C@]3(C)C2)OC1 |
| InChI | InChI=1S/C14H22O3/c1-12(2)8-16-14(17-9-12)5-10-4-11(15)6-13(10,3)7-14/h10H,4-9H2,1-3H3/t10-,13+/m0/s1 |
| InChIKey | KBUMIFASXSYPJJ-GXFFZTMASA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |