C16H21F3N2O3 — CID 21309660
tert-butyl (2R)-2-[[5-(trifluoromethyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate (PubChem CID 21309660) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[5-(trifluoromethyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[[5-(trifluoromethyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 21309660 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl (2R)-2-[[5-(trifluoromethyl)-3-pyridinyl]oxymethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1COc1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-15(2,3)24-14(22)21-6-4-5-12(21)10-23-13-7-11(8-20-9-13)16(17,18)19/h7-9,12H,4-6,10H2,1-3H3/t12-/m1/s1 |
| InChIKey | KTFPTCDRIMXKKN-GFCCVEGCSA-N |
| XLogP | 3.88 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |