C28H32O2 — CID 21310038
(3S,4R)-4-(4-hexylphenyl)-7-methoxy-3-phenyl-3,4-dihydro-2H-chromene (PubChem CID 21310038) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is (3S,4R)-4-(4-hexylphenyl)-7-methoxy-3-phenyl-3,4-dihydro-2H-chromene.
| Compound Name | (3S,4R)-4-(4-hexylphenyl)-7-methoxy-3-phenyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 21310038 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (3S,4R)-4-(4-hexylphenyl)-7-methoxy-3-phenyl-3,4-dihydro-2H-chromene |
| SMILES | CCCCCCc1ccc([C@@H]2c3ccc(OC)cc3OC[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H32O2/c1-3-4-5-7-10-21-13-15-23(16-14-21)28-25-18-17-24(29-2)19-27(25)30-20-26(28)22-11-8-6-9-12-22/h6,8-9,11-19,26,28H,3-5,7,10,20H2,1-2H3/t26-,28-/m1/s1 |
| InChIKey | MCIHEPCBWPDXTP-IXCJQBJRSA-N |
| XLogP | 7.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|