About 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol
3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol (PubChem CID 21310239) has the molecular formula C23H46N2O
and a molecular weight of 366.63 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol |
| PubChem CID | 21310239 |
| Molecular Formula | C23H46N2O |
| Molecular Weight | 366.63 g/mol |
| Exact Mass | 366.36 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol |
| SMILES | CCCCCCCCC(CCCCCCCC)C(CCO)C1=NCCN1 |
| InChI | InChI=1S/C23H46N2O/c1-3-5-7-9-11-13-15-21(16-14-12-10-8-6-4-2)22(17-20-26)23-24-18-19-25-23/h21-22,26H,3-20H2,1-2H3,(H,24,25) |
| InChIKey | ASAUHPOVTQCLHB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.63 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol (CID 21310239) is 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol is CCCCCCCCC(CCCCCCCC)C(CCO)C1=NCCN1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol?
The InChIKey is ASAUHPOVTQCLHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H46N2O/c1-3-5-7-9-11-13-15-21(16-14-12-10-8-6-4-2)22(17-20-26)23-24-18-19-25-23/h21-22,26H,3-20H2,1-2H3,(H,24,25).
What are the key properties of 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol?
3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol has a molecular weight of 366.63 g/mol, XLogP of 6.10, 18 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-2-yl)-4-octyldodecan-1-ol is sourced from PubChem (CID 21310239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).