C13H18O4S — CID 21310490
(2R,3R,4S,5S,6R)-2-benzylsulfanyl-6-methyloxane-3,4,5-triol (PubChem CID 21310490) has the molecular formula C13H18O4S and a molecular weight of 270.35 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-benzylsulfanyl-6-methyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-benzylsulfanyl-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 21310490 |
| Molecular Formula | C13H18O4S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-benzylsulfanyl-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1O[C@H](SCc2ccccc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O4S/c1-8-10(14)11(15)12(16)13(17-8)18-7-9-5-3-2-4-6-9/h2-6,8,10-16H,7H2,1H3/t8-,10-,11+,12-,13-/m1/s1 |
| InChIKey | SXSPOLWGIPKUDN-KABOQKQYSA-N |
| XLogP | 0.75 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |