C40H42Br2N2O2 — CID 21311048
1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-pentoxyphenyl)benzene-1,4-diamine (PubChem CID 21311048) has the molecular formula C40H42Br2N2O2 and a molecular weight of 742.60 g/mol. Its IUPAC name is 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-pentoxyphenyl)benzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-pentoxyphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 21311048 |
| Molecular Formula | C40H42Br2N2O2 |
| Molecular Weight | 742.60 g/mol |
| Exact Mass | 740.16 |
| IUPAC Name | 1-N,4-N-bis(4-bromophenyl)-1-N,4-N-bis(4-pentoxyphenyl)benzene-1,4-diamine |
| SMILES | CCCCCOc1ccc(N(c2ccc(Br)cc2)c2ccc(N(c3ccc(Br)cc3)c3ccc(OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C40H42Br2N2O2/c1-3-5-7-29-45-39-25-21-37(22-26-39)43(33-13-9-31(41)10-14-33)35-17-19-36(20-18-35)44(34-15-11-32(42)12-16-34)38-23-27-40(28-24-38)46-30-8-6-4-2/h9-28H,3-8,29-30H2,1-2H3 |
| InChIKey | JGJLJEHAJYUFIZ-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.60 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|