About 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one
2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one (PubChem CID 21311474) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one.
Molecular Properties
| Compound Name | 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one |
| PubChem CID | 21311474 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one |
| SMILES | CCC(O)CN1N=CCCC1=O |
| InChI | InChI=1S/C8H14N2O2/c1-2-7(11)6-10-8(12)4-3-5-9-10/h5,7,11H,2-4,6H2,1H3 |
| InChIKey | ODGRSEZNGPEHLY-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one?
The IUPAC name of 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one (CID 21311474) is 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one.
What is the SMILES notation for 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one?
The canonical SMILES for 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one is CCC(O)CN1N=CCCC1=O.
What is the InChIKey of 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one?
The InChIKey is ODGRSEZNGPEHLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-2-7(11)6-10-8(12)4-3-5-9-10/h5,7,11H,2-4,6H2,1H3.
What are the key properties of 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one?
2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one has a molecular weight of 170.21 g/mol, XLogP of 0.37, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxybutyl)-4,5-dihydropyridazin-3-one is sourced from PubChem (CID 21311474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).