C12H16N2S — CID 21311485
3,6,7,7a,8,9,11a,11b-octahydropyrazino[2,1-a]isoquinoline-4-thione (PubChem CID 21311485) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 3,6,7,7a,8,9,11a,11b-octahydropyrazino[2,1-a]isoquinoline-4-thione.
| Compound Name | 3,6,7,7a,8,9,11a,11b-octahydropyrazino[2,1-a]isoquinoline-4-thione |
|---|---|
| PubChem CID | 21311485 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 3,6,7,7a,8,9,11a,11b-octahydropyrazino[2,1-a]isoquinoline-4-thione |
| SMILES | S=C1CN=CC2C3C=CCCC3CCN12 |
| InChI | InChI=1S/C12H16N2S/c15-12-8-13-7-11-10-4-2-1-3-9(10)5-6-14(11)12/h2,4,7,9-11H,1,3,5-6,8H2 |
| InChIKey | YEIJOJLUUOKEMW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|