About 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane
2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane (PubChem CID 21312382) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane.
Molecular Properties
| Compound Name | 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane |
| PubChem CID | 21312382 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane |
| SMILES | CC1(C)C=CC=C(OCC2CO2)C1 |
| InChI | InChI=1S/C11H16O2/c1-11(2)5-3-4-9(6-11)12-7-10-8-13-10/h3-5,10H,6-8H2,1-2H3 |
| InChIKey | SYSBFIFNNCYBNZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane?
The IUPAC name of 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane (CID 21312382) is 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane.
What is the SMILES notation for 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane?
The canonical SMILES for 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane is CC1(C)C=CC=C(OCC2CO2)C1.
What is the InChIKey of 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane?
The InChIKey is SYSBFIFNNCYBNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-11(2)5-3-4-9(6-11)12-7-10-8-13-10/h3-5,10H,6-8H2,1-2H3.
What are the key properties of 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane?
2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane has a molecular weight of 180.25 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5,5-dimethylcyclohexa-1,3-dien-1-yl)oxymethyl]oxirane is sourced from PubChem (CID 21312382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).