About 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium
7-chloro-2,3-dimethylbenzo[f]chromen-4-ium (PubChem CID 21312468) has the molecular formula C15H12ClO+
and a molecular weight of 243.71 g/mol. Its IUPAC name is 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium.
Molecular Properties
| Compound Name | 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium |
| PubChem CID | 21312468 |
| Molecular Formula | C15H12ClO+ |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium |
| SMILES | Cc1cc2c(ccc3c(Cl)cccc32)[o+]c1C |
| InChI | InChI=1S/C15H12ClO/c1-9-8-13-11-4-3-5-14(16)12(11)6-7-15(13)17-10(9)2/h3-8H,1-2H3/q+1 |
| InChIKey | PTYNOADBWYHIOU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium?
The IUPAC name of 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium (CID 21312468) is 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium.
What is the SMILES notation for 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium?
The canonical SMILES for 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium is Cc1cc2c(ccc3c(Cl)cccc32)[o+]c1C.
What is the InChIKey of 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium?
The InChIKey is PTYNOADBWYHIOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12ClO/c1-9-8-13-11-4-3-5-14(16)12(11)6-7-15(13)17-10(9)2/h3-8H,1-2H3/q+1.
What are the key properties of 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium?
7-chloro-2,3-dimethylbenzo[f]chromen-4-ium has a molecular weight of 243.71 g/mol, XLogP of 5.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,3-dimethylbenzo[f]chromen-4-ium is sourced from PubChem (CID 21312468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).