About 1-chloro-2,6-dimethylnaphthalene
1-chloro-2,6-dimethylnaphthalene (PubChem CID 21312590) has the molecular formula C12H11Cl
and a molecular weight of 190.67 g/mol. Its IUPAC name is 1-chloro-2,6-dimethylnaphthalene.
Molecular Properties
| Compound Name | 1-chloro-2,6-dimethylnaphthalene |
| PubChem CID | 21312590 |
| Molecular Formula | C12H11Cl |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 1-chloro-2,6-dimethylnaphthalene |
| SMILES | Cc1ccc2c(Cl)c(C)ccc2c1 |
| InChI | InChI=1S/C12H11Cl/c1-8-3-6-11-10(7-8)5-4-9(2)12(11)13/h3-7H,1-2H3 |
| InChIKey | JBSKLZDEEUTKLK-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-chloro-2,6-dimethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2,6-dimethylnaphthalene?
The IUPAC name of 1-chloro-2,6-dimethylnaphthalene (CID 21312590) is 1-chloro-2,6-dimethylnaphthalene.
What is the SMILES notation for 1-chloro-2,6-dimethylnaphthalene?
The canonical SMILES for 1-chloro-2,6-dimethylnaphthalene is Cc1ccc2c(Cl)c(C)ccc2c1.
What is the InChIKey of 1-chloro-2,6-dimethylnaphthalene?
The InChIKey is JBSKLZDEEUTKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl/c1-8-3-6-11-10(7-8)5-4-9(2)12(11)13/h3-7H,1-2H3.
What are the key properties of 1-chloro-2,6-dimethylnaphthalene?
1-chloro-2,6-dimethylnaphthalene has a molecular weight of 190.67 g/mol, XLogP of 4.11, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2,6-dimethylnaphthalene is sourced from PubChem (CID 21312590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).