About 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one
2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one (PubChem CID 21312684) has the molecular formula C13H23NO3
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one.
Molecular Properties
| Compound Name | 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one |
| PubChem CID | 21312684 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one |
| SMILES | CC1=COC1=O.CCC1(C(C)C)NCCCO1 |
| InChI | InChI=1S/C9H19NO.C4H4O2/c1-4-9(8(2)3)10-6-5-7-11-9;1-3-2-6-4(3)5/h8,10H,4-7H2,1-3H3;2H,1H3 |
| InChIKey | OFRZTFKMABLCCZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one?
The IUPAC name of 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one (CID 21312684) is 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one.
What is the SMILES notation for 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one?
The canonical SMILES for 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one is CC1=COC1=O.CCC1(C(C)C)NCCCO1.
What is the InChIKey of 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one?
The InChIKey is OFRZTFKMABLCCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.C4H4O2/c1-4-9(8(2)3)10-6-5-7-11-9;1-3-2-6-4(3)5/h8,10H,4-7H2,1-3H3;2H,1H3.
What are the key properties of 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one?
2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one has a molecular weight of 241.33 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-propan-2-yl-1,3-oxazinane;3-methyloxet-2-one is sourced from PubChem (CID 21312684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).