About 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone
2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone (PubChem CID 21312878) has the molecular formula C22H30O9P2
and a molecular weight of 500.42 g/mol. Its IUPAC name is 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone |
| PubChem CID | 21312878 |
| Molecular Formula | C22H30O9P2 |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone |
| SMILES | COP(=O)(CCOC(OCCP(=O)(OC)OC)(C(=O)c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C22H30O9P2/c1-26-32(24,27-2)17-15-30-22(20-13-9-6-10-14-20,21(23)19-11-7-5-8-12-19)31-16-18-33(25,28-3)29-4/h5-14H,15-18H2,1-4H3 |
| InChIKey | FNQBVVQOIVIPMH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone?
The IUPAC name of 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone (CID 21312878) is 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone.
What is the SMILES notation for 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone?
The canonical SMILES for 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone is COP(=O)(CCOC(OCCP(=O)(OC)OC)(C(=O)c1ccccc1)c1ccccc1)OC.
What is the InChIKey of 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone?
The InChIKey is FNQBVVQOIVIPMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O9P2/c1-26-32(24,27-2)17-15-30-22(20-13-9-6-10-14-20,21(23)19-11-7-5-8-12-19)31-16-18-33(25,28-3)29-4/h5-14H,15-18H2,1-4H3.
What are the key properties of 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone?
2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone has a molecular weight of 500.42 g/mol, XLogP of 4.73, 15 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(2-dimethoxyphosphorylethoxy)-1,2-diphenylethanone is sourced from PubChem (CID 21312878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).