About 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid
2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid (PubChem CID 21312919) has the molecular formula C6H6N2O5
and a molecular weight of 186.12 g/mol. Its IUPAC name is 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid |
| PubChem CID | 21312919 |
| Molecular Formula | C6H6N2O5 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.03 |
| IUPAC Name | 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1noc(CC(=O)O)n1 |
| InChI | InChI=1S/C6H6N2O5/c9-5(10)1-3-7-4(13-8-3)2-6(11)12/h1-2H2,(H,9,10)(H,11,12) |
| InChIKey | ANYVFOJLQKTQKU-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid (CID 21312919) is 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid is O=C(O)Cc1noc(CC(=O)O)n1.
What is the InChIKey of 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The InChIKey is ANYVFOJLQKTQKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O5/c9-5(10)1-3-7-4(13-8-3)2-6(11)12/h1-2H2,(H,9,10)(H,11,12).
What are the key properties of 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid?
2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid has a molecular weight of 186.12 g/mol, XLogP of -0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(carboxymethyl)-1,2,4-oxadiazol-3-yl]acetic acid is sourced from PubChem (CID 21312919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).