About methanol;trimethylazanium;hydroxide
methanol;trimethylazanium;hydroxide (PubChem CID 21313545) has the molecular formula C4H15NO2
and a molecular weight of 109.17 g/mol. Its IUPAC name is methanol;trimethylazanium;hydroxide.
Molecular Properties
| Compound Name | methanol;trimethylazanium;hydroxide |
| PubChem CID | 21313545 |
| Molecular Formula | C4H15NO2 |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.11 |
| IUPAC Name | methanol;trimethylazanium;hydroxide |
| SMILES | CO.C[NH+](C)C.[OH-] |
| InChI | InChI=1S/C3H9N.CH4O.H2O/c1-4(2)3;1-2;/h1-3H3;2H,1H3;1H2 |
| InChIKey | JWUQTBNFAXXJJF-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methanol;trimethylazanium;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;trimethylazanium;hydroxide?
The IUPAC name of methanol;trimethylazanium;hydroxide (CID 21313545) is methanol;trimethylazanium;hydroxide.
What is the SMILES notation for methanol;trimethylazanium;hydroxide?
The canonical SMILES for methanol;trimethylazanium;hydroxide is CO.C[NH+](C)C.[OH-].
What is the InChIKey of methanol;trimethylazanium;hydroxide?
The InChIKey is JWUQTBNFAXXJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.CH4O.H2O/c1-4(2)3;1-2;/h1-3H3;2H,1H3;1H2.
What are the key properties of methanol;trimethylazanium;hydroxide?
methanol;trimethylazanium;hydroxide has a molecular weight of 109.17 g/mol, XLogP of -1.81, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;trimethylazanium;hydroxide is sourced from PubChem (CID 21313545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).