About acetyloxy(ethyl)mercury
acetyloxy(ethyl)mercury (PubChem CID 21313703) has the molecular formula C4H8HgO2
and a molecular weight of 288.70 g/mol. Its IUPAC name is acetyloxy(ethyl)mercury.
Molecular Properties
| Compound Name | acetyloxy(ethyl)mercury |
| PubChem CID | 21313703 |
| Molecular Formula | C4H8HgO2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | acetyloxy(ethyl)mercury |
| SMILES | CC[Hg]OC(C)=O |
| InChI | InChI=1S/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1 |
| InChIKey | UVCFFGYNJOPUSF-UHFFFAOYSA-M |
| XLogP | 0.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze acetyloxy(ethyl)mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyloxy(ethyl)mercury?
The IUPAC name of acetyloxy(ethyl)mercury (CID 21313703) is acetyloxy(ethyl)mercury.
What is the SMILES notation for acetyloxy(ethyl)mercury?
The canonical SMILES for acetyloxy(ethyl)mercury is CC[Hg]OC(C)=O.
What is the InChIKey of acetyloxy(ethyl)mercury?
The InChIKey is UVCFFGYNJOPUSF-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.C2H5.Hg/c1-2(3)4;1-2;/h1H3,(H,3,4);1H2,2H3;/q;;+1/p-1.
What are the key properties of acetyloxy(ethyl)mercury?
acetyloxy(ethyl)mercury has a molecular weight of 288.70 g/mol, XLogP of 0.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetyloxy(ethyl)mercury is sourced from PubChem (CID 21313703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).