About [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate
[2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate (PubChem CID 21314243) has the molecular formula C17H20F2N2O2
and a molecular weight of 322.36 g/mol. Its IUPAC name is [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate.
Molecular Properties
| Compound Name | [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate |
| PubChem CID | 21314243 |
| Molecular Formula | C17H20F2N2O2 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate |
| SMILES | Cc1cc(OC(=O)CC(C)C)n(C(C)c2ccc(F)c(F)c2)n1 |
| InChI | InChI=1S/C17H20F2N2O2/c1-10(2)7-17(22)23-16-8-11(3)20-21(16)12(4)13-5-6-14(18)15(19)9-13/h5-6,8-10,12H,7H2,1-4H3 |
| InChIKey | SLQQNUUGSDWCQT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate?
The IUPAC name of [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate (CID 21314243) is [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate.
What is the SMILES notation for [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate?
The canonical SMILES for [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate is Cc1cc(OC(=O)CC(C)C)n(C(C)c2ccc(F)c(F)c2)n1.
What is the InChIKey of [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate?
The InChIKey is SLQQNUUGSDWCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20F2N2O2/c1-10(2)7-17(22)23-16-8-11(3)20-21(16)12(4)13-5-6-14(18)15(19)9-13/h5-6,8-10,12H,7H2,1-4H3.
What are the key properties of [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate?
[2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate has a molecular weight of 322.36 g/mol, XLogP of 4.03, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,4-difluorophenyl)ethyl]-5-methylpyrazol-3-yl] 3-methylbutanoate is sourced from PubChem (CID 21314243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).