C22H23FN2O3S — CID 21314276
[5-methyl-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]pyrazol-3-yl] 4-fluorobenzenesulfonate (PubChem CID 21314276) has the molecular formula C22H23FN2O3S and a molecular weight of 414.50 g/mol. Its IUPAC name is [5-methyl-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]pyrazol-3-yl] 4-fluorobenzenesulfonate.
| Compound Name | [5-methyl-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]pyrazol-3-yl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 21314276 |
| Molecular Formula | C22H23FN2O3S |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [5-methyl-2-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]pyrazol-3-yl] 4-fluorobenzenesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)c2ccc(F)cc2)n(C(C)c2ccc3c(c2)CCCC3)n1 |
| InChI | InChI=1S/C22H23FN2O3S/c1-15-13-22(28-29(26,27)21-11-9-20(23)10-12-21)25(24-15)16(2)18-8-7-17-5-3-4-6-19(17)14-18/h7-14,16H,3-6H2,1-2H3 |
| InChIKey | GTFROQINTXANKX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|