About [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane
[2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane (PubChem CID 21314301) has the molecular formula C16H18Cl2N2O3
and a molecular weight of 357.24 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane.
Molecular Properties
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane |
| PubChem CID | 21314301 |
| Molecular Formula | C16H18Cl2N2O3 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane |
| SMILES | C1CO1.CC(=O)Oc1cc(C)nn1C(C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2.C2H4O/c1-8-6-14(20-10(3)19)18(17-8)9(2)11-4-5-12(15)13(16)7-11;1-2-3-1/h4-7,9H,1-3H3;1-2H2 |
| InChIKey | IUJBIFUUXRRBNY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 56.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane?
The IUPAC name of [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane (CID 21314301) is [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane.
What is the SMILES notation for [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane?
The canonical SMILES for [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane is C1CO1.CC(=O)Oc1cc(C)nn1C(C)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane?
The InChIKey is IUJBIFUUXRRBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14Cl2N2O2.C2H4O/c1-8-6-14(20-10(3)19)18(17-8)9(2)11-4-5-12(15)13(16)7-11;1-2-3-1/h4-7,9H,1-3H3;1-2H2.
What are the key properties of [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane?
[2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane has a molecular weight of 357.24 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,4-dichlorophenyl)ethyl]-5-methylpyrazol-3-yl] acetate;oxirane is sourced from PubChem (CID 21314301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).