About [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate
[2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate (PubChem CID 21314302) has the molecular formula C19H17Cl2FN2O3S
and a molecular weight of 443.33 g/mol. Its IUPAC name is [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate |
| PubChem CID | 21314302 |
| Molecular Formula | C19H17Cl2FN2O3S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate |
| SMILES | Cc1nn(C(C)c2ccc(Cl)c(Cl)c2)c(OS(=O)(=O)c2ccccc2F)c1C |
| InChI | InChI=1S/C19H17Cl2FN2O3S/c1-11-12(2)23-24(13(3)14-8-9-15(20)16(21)10-14)19(11)27-28(25,26)18-7-5-4-6-17(18)22/h4-10,13H,1-3H3 |
| InChIKey | RCMYIEKUCHGKOG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate?
The IUPAC name of [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate (CID 21314302) is [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate.
What is the SMILES notation for [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate?
The canonical SMILES for [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate is Cc1nn(C(C)c2ccc(Cl)c(Cl)c2)c(OS(=O)(=O)c2ccccc2F)c1C.
What is the InChIKey of [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate?
The InChIKey is RCMYIEKUCHGKOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2FN2O3S/c1-11-12(2)23-24(13(3)14-8-9-15(20)16(21)10-14)19(11)27-28(25,26)18-7-5-4-6-17(18)22/h4-10,13H,1-3H3.
What are the key properties of [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate?
[2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate has a molecular weight of 443.33 g/mol, XLogP of 5.32, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(3,4-dichlorophenyl)ethyl]-4,5-dimethylpyrazol-3-yl] 2-fluorobenzenesulfonate is sourced from PubChem (CID 21314302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).