About [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol
[5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol (PubChem CID 21314375) has the molecular formula C21H27N3O6
and a molecular weight of 417.46 g/mol. Its IUPAC name is [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol |
| PubChem CID | 21314375 |
| Molecular Formula | C21H27N3O6 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol |
| SMILES | OCc1ccc(CC2CN(Cc3ccc(CO)o3)NN(Cc3ccc(CO)o3)C2)o1 |
| InChI | InChI=1S/C21H27N3O6/c25-12-19-4-1-16(28-19)7-15-8-23(10-17-2-5-20(13-26)29-17)22-24(9-15)11-18-3-6-21(14-27)30-18/h1-6,15,22,25-27H,7-14H2 |
| InChIKey | LNJUJSGHTXDGGE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol?
The IUPAC name of [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol (CID 21314375) is [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol.
What is the SMILES notation for [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol?
The canonical SMILES for [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol is OCc1ccc(CC2CN(Cc3ccc(CO)o3)NN(Cc3ccc(CO)o3)C2)o1.
What is the InChIKey of [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol?
The InChIKey is LNJUJSGHTXDGGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3O6/c25-12-19-4-1-16(28-19)7-15-8-23(10-17-2-5-20(13-26)29-17)22-24(9-15)11-18-3-6-21(14-27)30-18/h1-6,15,22,25-27H,7-14H2.
What are the key properties of [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol?
[5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol has a molecular weight of 417.46 g/mol, XLogP of 1.54, 9 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[1,3-bis[[5-(hydroxymethyl)furan-2-yl]methyl]triazinan-5-yl]methyl]furan-2-yl]methanol is sourced from PubChem (CID 21314375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).