C19H29N3OS — CID 21314696
2-tert-butylimino-6-phenyl-3,5-di(propan-2-yl)-1,3,5-thiadiazinan-4-one (PubChem CID 21314696) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 2-tert-butylimino-6-phenyl-3,5-di(propan-2-yl)-1,3,5-thiadiazinan-4-one.
| Compound Name | 2-tert-butylimino-6-phenyl-3,5-di(propan-2-yl)-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 21314696 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2-tert-butylimino-6-phenyl-3,5-di(propan-2-yl)-1,3,5-thiadiazinan-4-one |
| SMILES | CC(C)N1C(=O)N(C(C)C)C(c2ccccc2)S/C1=N\C(C)(C)C |
| InChI | InChI=1S/C19H29N3OS/c1-13(2)21-16(15-11-9-8-10-12-15)24-17(20-19(5,6)7)22(14(3)4)18(21)23/h8-14,16H,1-7H3/b20-17- |
| InChIKey | DNFFBEBPIKCEKA-JZJYNLBNSA-N |
| XLogP | 5.13 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|