C13H15N3O2S2 — CID 2131481
2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-prop-2-enylacetamide (PubChem CID 2131481) has the molecular formula C13H15N3O2S2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-prop-2-enylacetamide.
| Compound Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 2131481 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanyl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nc2sc(C)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C13H15N3O2S2/c1-4-5-14-9(17)6-19-13-15-11(18)10-7(2)8(3)20-12(10)16-13/h4H,1,5-6H2,2-3H3,(H,14,17)(H,15,16,18) |
| InChIKey | UIVVYZRAUCJZHH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|