C14H14F6N2O3 — CID 21314951
2-[4-[4,5-dihydro-1,3-oxazol-2-yl(methyl)amino]-3-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 21314951) has the molecular formula C14H14F6N2O3 and a molecular weight of 372.27 g/mol. Its IUPAC name is 2-[4-[4,5-dihydro-1,3-oxazol-2-yl(methyl)amino]-3-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[4,5-dihydro-1,3-oxazol-2-yl(methyl)amino]-3-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 21314951 |
| Molecular Formula | C14H14F6N2O3 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[4-[4,5-dihydro-1,3-oxazol-2-yl(methyl)amino]-3-methoxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | COc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1N(C)C1=NCCO1 |
| InChI | InChI=1S/C14H14F6N2O3/c1-22(11-21-5-6-25-11)9-4-3-8(7-10(9)24-2)12(23,13(15,16)17)14(18,19)20/h3-4,7,23H,5-6H2,1-2H3 |
| InChIKey | LMNUYHWYKZBXQF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |