About thiepino[4,5-c]pyridine
thiepino[4,5-c]pyridine (PubChem CID 21315519) has the molecular formula C9H7NS
and a molecular weight of 161.23 g/mol. Its IUPAC name is thiepino[4,5-c]pyridine.
Molecular Properties
| Compound Name | thiepino[4,5-c]pyridine |
| PubChem CID | 21315519 |
| Molecular Formula | C9H7NS |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | thiepino[4,5-c]pyridine |
| SMILES | C1=Cc2ccncc2C=CS1 |
| InChI | InChI=1S/C9H7NS/c1-4-10-7-9-3-6-11-5-2-8(1)9/h1-7H |
| InChIKey | NQZANEQMWNEWHF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze thiepino[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiepino[4,5-c]pyridine?
The IUPAC name of thiepino[4,5-c]pyridine (CID 21315519) is thiepino[4,5-c]pyridine.
What is the SMILES notation for thiepino[4,5-c]pyridine?
The canonical SMILES for thiepino[4,5-c]pyridine is C1=Cc2ccncc2C=CS1.
What is the InChIKey of thiepino[4,5-c]pyridine?
The InChIKey is NQZANEQMWNEWHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS/c1-4-10-7-9-3-6-11-5-2-8(1)9/h1-7H.
What are the key properties of thiepino[4,5-c]pyridine?
thiepino[4,5-c]pyridine has a molecular weight of 161.23 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for thiepino[4,5-c]pyridine is sourced from PubChem (CID 21315519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).