C10H18O7 — CID 21315665
(E)-but-2-enedioic acid;2-ethyl-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 21315665) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-ethyl-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | (E)-but-2-enedioic acid;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 21315665 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (E)-but-2-enedioic acid;2-ethyl-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | CCC(CO)(CO)CO.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C6H14O3.C4H4O4/c1-2-6(3-7,4-8)5-9;5-3(6)1-2-4(7)8/h7-9H,2-5H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | TUIKVTLNQXJRFO-WLHGVMLRSA-N |
| XLogP | -0.93 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|