About N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide
N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide (PubChem CID 21315965) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide |
| PubChem CID | 21315965 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1C=CCNC1 |
| InChI | InChI=1S/C8H15N3O/c1-8(12)10-4-6-11-5-2-3-9-7-11/h2,5,9H,3-4,6-7H2,1H3,(H,10,12) |
| InChIKey | KDEGFIPSRVPAPC-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide?
The IUPAC name of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide (CID 21315965) is N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide.
What is the SMILES notation for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide?
The canonical SMILES for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide is CC(=O)NCCN1C=CCNC1.
What is the InChIKey of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide?
The InChIKey is KDEGFIPSRVPAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-8(12)10-4-6-11-5-2-3-9-7-11/h2,5,9H,3-4,6-7H2,1H3,(H,10,12).
What are the key properties of N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide?
N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide has a molecular weight of 169.23 g/mol, XLogP of -0.50, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2,6-dihydro-1H-pyrimidin-3-yl)ethyl]acetamide is sourced from PubChem (CID 21315965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).