C18H38N4S4 — CID 21316281
4,7,13,16-tetrathia-1,10,21,24-tetrazabicyclo[8.8.8]hexacosane (PubChem CID 21316281) has the molecular formula C18H38N4S4 and a molecular weight of 438.80 g/mol. Its IUPAC name is 4,7,13,16-tetrathia-1,10,21,24-tetrazabicyclo[8.8.8]hexacosane.
| Compound Name | 4,7,13,16-tetrathia-1,10,21,24-tetrazabicyclo[8.8.8]hexacosane |
|---|---|
| PubChem CID | 21316281 |
| Molecular Formula | C18H38N4S4 |
| Molecular Weight | 438.80 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 4,7,13,16-tetrathia-1,10,21,24-tetrazabicyclo[8.8.8]hexacosane |
| SMILES | C1CNCCN2CCSCCSCCN(CCN1)CCSCCSCC2 |
| InChI | InChI=1S/C18H38N4S4/c1-2-20-4-6-22-9-13-25-17-15-23-11-7-21(5-3-19-1)8-12-24-16-18-26-14-10-22/h19-20H,1-18H2 |
| InChIKey | FHOKTSYDHYLWRM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.80 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |