C10H18Cl4S2 — CID 21316306
2,5-dichloro-1,6-bis(2-chloroethylsulfanyl)hexane (PubChem CID 21316306) has the molecular formula C10H18Cl4S2 and a molecular weight of 344.20 g/mol. Its IUPAC name is 2,5-dichloro-1,6-bis(2-chloroethylsulfanyl)hexane.
| Compound Name | 2,5-dichloro-1,6-bis(2-chloroethylsulfanyl)hexane |
|---|---|
| PubChem CID | 21316306 |
| Molecular Formula | C10H18Cl4S2 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | 2,5-dichloro-1,6-bis(2-chloroethylsulfanyl)hexane |
| SMILES | ClCCSCC(Cl)CCC(Cl)CSCCCl |
| InChI | InChI=1S/C10H18Cl4S2/c11-3-5-15-7-9(13)1-2-10(14)8-16-6-4-12/h9-10H,1-8H2 |
| InChIKey | GIHNOGXOHWHRQX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|